C34H35F7O3 — CID 59328937
2-[4-[4-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 59328937) has the molecular formula C34H35F7O3 and a molecular weight of 624.64 g/mol. Its IUPAC name is 2-[4-[4-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 59328937 |
| Molecular Formula | C34H35F7O3 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 2-[4-[4-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(-c3cc(F)c(C(F)(F)OC4CCC(c5ccc(F)c(F)c5)CC4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C34H35F7O3/c1-2-3-4-5-20-18-42-33(43-19-20)23-8-12-26(28(36)15-23)24-16-30(38)32(31(39)17-24)34(40,41)44-25-10-6-21(7-11-25)22-9-13-27(35)29(37)14-22/h8-9,12-17,20-21,25,33H,2-7,10-11,18-19H2,1H3 |
| InChIKey | WNCCLMBCCZRAIC-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|