C36H41F5O — CID 59328968
1-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzene (PubChem CID 59328968) has the molecular formula C36H41F5O and a molecular weight of 584.71 g/mol. Its IUPAC name is 1-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 1-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 59328968 |
| Molecular Formula | C36H41F5O |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 1-[[4-(3,4-difluorophenyl)cyclohexyl]oxy-difluoromethyl]-2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(C(F)(F)OC4CCC(c5ccc(F)c(F)c5)CC4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C36H41F5O/c1-2-3-4-5-24-6-8-25(9-7-24)26-10-12-27(13-11-26)29-16-20-32(34(38)22-29)36(40,41)42-31-18-14-28(15-19-31)30-17-21-33(37)35(39)23-30/h10-13,16-17,20-25,28,31H,2-9,14-15,18-19H2,1H3 |
| InChIKey | GPIMCBRFWLAEIF-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|