C23H27F3 — CID 10882919
1,2-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene (PubChem CID 10882919) has the molecular formula C23H27F3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1,2-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 1,2-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 10882919 |
| Molecular Formula | C23H27F3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1,2-difluoro-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H27F3/c1-2-3-4-5-16-6-8-17(9-7-16)18-10-12-20(22(25)14-18)19-11-13-21(24)23(26)15-19/h10-17H,2-9H2,1H3 |
| InChIKey | QMHXNJZQSYSAIC-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|