C23H28F3N — CID 67688098
2,3-difluoro-5-[2-fluoro-4-(4-hexylcyclohexyl)phenyl]pyridine (PubChem CID 67688098) has the molecular formula C23H28F3N and a molecular weight of 375.48 g/mol. Its IUPAC name is 2,3-difluoro-5-[2-fluoro-4-(4-hexylcyclohexyl)phenyl]pyridine.
| Compound Name | 2,3-difluoro-5-[2-fluoro-4-(4-hexylcyclohexyl)phenyl]pyridine |
|---|---|
| PubChem CID | 67688098 |
| Molecular Formula | C23H28F3N |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2,3-difluoro-5-[2-fluoro-4-(4-hexylcyclohexyl)phenyl]pyridine |
| SMILES | CCCCCCC1CCC(c2ccc(-c3cnc(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H28F3N/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-12-20(21(24)13-18)19-14-22(25)23(26)27-15-19/h11-17H,2-10H2,1H3 |
| InChIKey | VNVHAJODELKNEA-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|