C33H39F — CID 19906956
1-[4-[(E)-2-(4-ethylphenyl)ethenyl]phenyl]-2-fluoro-4-(4-pentylcyclohexyl)benzene (PubChem CID 19906956) has the molecular formula C33H39F and a molecular weight of 454.67 g/mol. Its IUPAC name is 1-[4-[(E)-2-(4-ethylphenyl)ethenyl]phenyl]-2-fluoro-4-(4-pentylcyclohexyl)benzene.
| Compound Name | 1-[4-[(E)-2-(4-ethylphenyl)ethenyl]phenyl]-2-fluoro-4-(4-pentylcyclohexyl)benzene |
|---|---|
| PubChem CID | 19906956 |
| Molecular Formula | C33H39F |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 1-[4-[(E)-2-(4-ethylphenyl)ethenyl]phenyl]-2-fluoro-4-(4-pentylcyclohexyl)benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(/C=C/c4ccc(CC)cc4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C33H39F/c1-3-5-6-7-26-14-18-29(19-15-26)31-22-23-32(33(34)24-31)30-20-16-28(17-21-30)13-12-27-10-8-25(4-2)9-11-27/h8-13,16-17,20-24,26,29H,3-7,14-15,18-19H2,1-2H3/b13-12+ |
| InChIKey | CLWHEECNMPGEDF-OUKQBFOZSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|