C29H40BFO2 — CID 155655000
2-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155655000) has the molecular formula C29H40BFO2 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155655000 |
| Molecular Formula | C29H40BFO2 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 2-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H40BFO2/c1-6-7-8-9-21-10-12-22(13-11-21)24-16-19-26(27(31)20-24)23-14-17-25(18-15-23)30-32-28(2,3)29(4,5)33-30/h14-22H,6-13H2,1-5H3 |
| InChIKey | LJQFOEAORABKHS-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|