C30H39F3 — CID 126551441
1,3-difluoro-5-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-methylbenzene (PubChem CID 126551441) has the molecular formula C30H39F3 and a molecular weight of 456.64 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-methylbenzene.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-methylbenzene |
|---|---|
| PubChem CID | 126551441 |
| Molecular Formula | C30H39F3 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-methylbenzene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(-c4cc(F)c(C)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H39F3/c1-3-4-5-6-21-7-9-22(10-8-21)23-11-13-24(14-12-23)25-15-16-27(30(33)17-25)26-18-28(31)20(2)29(32)19-26/h15-19,21-24H,3-14H2,1-2H3 |
| InChIKey | RAFYCLQIFHTIQS-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|