C33H39FO2 — CID 18596409
(4-propylphenyl) 4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzoate (PubChem CID 18596409) has the molecular formula C33H39FO2 and a molecular weight of 486.67 g/mol. Its IUPAC name is (4-propylphenyl) 4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzoate.
| Compound Name | (4-propylphenyl) 4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 18596409 |
| Molecular Formula | C33H39FO2 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | (4-propylphenyl) 4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]benzoate |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(C(=O)Oc4ccc(CCC)cc4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C33H39FO2/c1-3-5-6-8-25-9-13-26(14-10-25)29-19-22-31(32(34)23-29)27-15-17-28(18-16-27)33(35)36-30-20-11-24(7-4-2)12-21-30/h11-12,15-23,25-26H,3-10,13-14H2,1-2H3 |
| InChIKey | IKUSOIJGPOZUKT-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|