About [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate
[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate (PubChem CID 70520806) has the molecular formula C32H45FO3
and a molecular weight of 496.71 g/mol. Its IUPAC name is [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate.
Molecular Properties
| Compound Name | [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate |
| PubChem CID | 70520806 |
| Molecular Formula | C32H45FO3 |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate |
| SMILES | CCCCCCC(C)OC(=O)Oc1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2F)cc1 |
| InChI | InChI=1S/C32H45FO3/c1-4-6-8-10-11-24(3)35-32(34)36-29-20-17-27(18-21-29)30-22-19-28(23-31(30)33)26-15-13-25(14-16-26)12-9-7-5-2/h17-26H,4-16H2,1-3H3 |
| InChIKey | WVSBDSZMYQHTKE-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate?
The IUPAC name of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate (CID 70520806) is [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate.
What is the SMILES notation for [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate?
The canonical SMILES for [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate is CCCCCCC(C)OC(=O)Oc1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2F)cc1.
What is the InChIKey of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate?
The InChIKey is WVSBDSZMYQHTKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H45FO3/c1-4-6-8-10-11-24(3)35-32(34)36-29-20-17-27(18-21-29)30-22-19-28(23-31(30)33)26-15-13-25(14-16-26)12-9-7-5-2/h17-26H,4-16H2,1-3H3.
What are the key properties of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate?
[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate has a molecular weight of 496.71 g/mol, XLogP of 10.22, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] octan-2-yl carbonate is sourced from PubChem (CID 70520806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).