C32H43FO3 — CID 70520736
[4-[4-(4-butylcyclohexyl)-2-fluorophenyl]phenyl] (4-propylcyclohexyl) carbonate (PubChem CID 70520736) has the molecular formula C32H43FO3 and a molecular weight of 494.69 g/mol. Its IUPAC name is [4-[4-(4-butylcyclohexyl)-2-fluorophenyl]phenyl] (4-propylcyclohexyl) carbonate.
| Compound Name | [4-[4-(4-butylcyclohexyl)-2-fluorophenyl]phenyl] (4-propylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 70520736 |
| Molecular Formula | C32H43FO3 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | [4-[4-(4-butylcyclohexyl)-2-fluorophenyl]phenyl] (4-propylcyclohexyl) carbonate |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(OC(=O)OC4CCC(CCC)CC4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H43FO3/c1-3-5-7-24-8-12-25(13-9-24)27-16-21-30(31(33)22-27)26-14-19-29(20-15-26)36-32(34)35-28-17-10-23(6-4-2)11-18-28/h14-16,19-25,28H,3-13,17-18H2,1-2H3 |
| InChIKey | COVXICSVBIGRMJ-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|