About (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate
(4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate (PubChem CID 70484285) has the molecular formula C30H33FO4
and a molecular weight of 476.59 g/mol. Its IUPAC name is (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate.
Molecular Properties
| Compound Name | (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate |
| PubChem CID | 70484285 |
| Molecular Formula | C30H33FO4 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(OC(=O)Oc4ccc(OCC)cc4)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H33FO4/c1-3-5-21-6-8-22(9-7-21)24-12-19-28(29(31)20-24)23-10-13-26(14-11-23)34-30(32)35-27-17-15-25(16-18-27)33-4-2/h10-22H,3-9H2,1-2H3 |
| InChIKey | AXKRVOOYFHIOLI-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate?
The IUPAC name of (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate (CID 70484285) is (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate.
What is the SMILES notation for (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate?
The canonical SMILES for (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate is CCCC1CCC(c2ccc(-c3ccc(OC(=O)Oc4ccc(OCC)cc4)cc3)c(F)c2)CC1.
What is the InChIKey of (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate?
The InChIKey is AXKRVOOYFHIOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H33FO4/c1-3-5-21-6-8-22(9-7-21)24-12-19-28(29(31)20-24)23-10-13-26(14-11-23)34-30(32)35-27-17-15-25(16-18-27)33-4-2/h10-22H,3-9H2,1-2H3.
What are the key properties of (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate?
(4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate has a molecular weight of 476.59 g/mol, XLogP of 8.54, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyphenyl) [4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]phenyl] carbonate is sourced from PubChem (CID 70484285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).