C31H38F2N2 — CID 18650816
2-(3,4-difluorophenyl)-5-[4-(4-nonylcyclohexyl)phenyl]pyrimidine (PubChem CID 18650816) has the molecular formula C31H38F2N2 and a molecular weight of 476.66 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-[4-(4-nonylcyclohexyl)phenyl]pyrimidine.
| Compound Name | 2-(3,4-difluorophenyl)-5-[4-(4-nonylcyclohexyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 18650816 |
| Molecular Formula | C31H38F2N2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-[4-(4-nonylcyclohexyl)phenyl]pyrimidine |
| SMILES | CCCCCCCCCC1CCC(c2ccc(-c3cnc(-c4ccc(F)c(F)c4)nc3)cc2)CC1 |
| InChI | InChI=1S/C31H38F2N2/c1-2-3-4-5-6-7-8-9-23-10-12-24(13-11-23)25-14-16-26(17-15-25)28-21-34-31(35-22-28)27-18-19-29(32)30(33)20-27/h14-24H,2-13H2,1H3 |
| InChIKey | RDYJRNUPUIQKRV-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|