C53H54F8 — CID 160628288
6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene;1,2,3-trifluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]naphthalene (PubChem CID 160628288) has the molecular formula C53H54F8 and a molecular weight of 843.00 g/mol. Its IUPAC name is 6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene;1,2,3-trifluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]naphthalene.
| Compound Name | 6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene;1,2,3-trifluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 160628288 |
| Molecular Formula | C53H54F8 |
| Molecular Weight | 843.00 g/mol |
| Exact Mass | 842.41 |
| IUPAC Name | 6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1,2,3-trifluoronaphthalene;1,2,3-trifluoro-6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]naphthalene |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)CC1.CCCCCC1CCC(c2ccc(-c3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H28F4.C26H26F4/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-22(24(28)15-19)20-11-13-23-21(14-20)16-25(29)27(31)26(23)30;1-2-3-4-16-5-7-17(8-6-16)18-9-11-21(23(27)14-18)19-10-12-22-20(13-19)15-24(28)26(30)25(22)29/h10-18H,2-9H2,1H3;9-17H,2-8H2,1H3 |
| InChIKey | RHPAPYAYGAVTCS-UHFFFAOYSA-N |
| XLogP | 17.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.00 |
| LogP ≤ 5 | 17.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|