C30H31F7 — CID 139856611
6-[2,6-difluoro-4-(4-heptylcyclohexyl)phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene (PubChem CID 139856611) has the molecular formula C30H31F7 and a molecular weight of 524.56 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(4-heptylcyclohexyl)phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-[2,6-difluoro-4-(4-heptylcyclohexyl)phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856611 |
| Molecular Formula | C30H31F7 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 6-[2,6-difluoro-4-(4-heptylcyclohexyl)phenyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
| SMILES | CCCCCCCC1CCC(c2cc(F)c(-c3ccc4c(F)c(C(F)(F)F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C30H31F7/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)21-15-24(31)27(25(32)16-21)20-12-13-23-22(14-20)17-26(33)28(29(23)34)30(35,36)37/h12-19H,2-11H2,1H3 |
| InChIKey | OXXUPSPAPBHDIT-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|