C28H28F6O — CID 139855726
2-(difluoromethoxy)-6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,3-difluoronaphthalene (PubChem CID 139855726) has the molecular formula C28H28F6O and a molecular weight of 494.52 g/mol. Its IUPAC name is 2-(difluoromethoxy)-6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,3-difluoronaphthalene.
| Compound Name | 2-(difluoromethoxy)-6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139855726 |
| Molecular Formula | C28H28F6O |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-(difluoromethoxy)-6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,3-difluoronaphthalene |
| SMILES | CCCCCC1CCC(c2cc(F)c(-c3ccc4c(F)c(OC(F)F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H28F6O/c1-2-3-4-5-16-6-8-17(9-7-16)19-13-22(29)25(23(30)14-19)18-10-11-21-20(12-18)15-24(31)27(26(21)32)35-28(33)34/h10-17,28H,2-9H2,1H3 |
| InChIKey | YVFBNTMGOVLJFJ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|