C28H30F4O — CID 139849979
6-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-1,8-difluoronaphthalen-2-ol (PubChem CID 139849979) has the molecular formula C28H30F4O and a molecular weight of 458.54 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-1,8-difluoronaphthalen-2-ol.
| Compound Name | 6-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-1,8-difluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 139849979 |
| Molecular Formula | C28H30F4O |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 6-[2,6-difluoro-4-(4-hexylcyclohexyl)phenyl]-1,8-difluoronaphthalen-2-ol |
| SMILES | CCCCCCC1CCC(c2cc(F)c(-c3cc(F)c4c(F)c(O)ccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H30F4O/c1-2-3-4-5-6-17-7-9-18(10-8-17)20-14-22(29)26(23(30)15-20)21-13-19-11-12-25(33)28(32)27(19)24(31)16-21/h11-18,33H,2-10H2,1H3 |
| InChIKey | AGGOJOJWCJONDH-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|