C26H28F2O — CID 139850003
6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1-fluoronaphthalen-2-ol (PubChem CID 139850003) has the molecular formula C26H28F2O and a molecular weight of 394.51 g/mol. Its IUPAC name is 6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1-fluoronaphthalen-2-ol.
| Compound Name | 6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 139850003 |
| Molecular Formula | C26H28F2O |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 6-[4-(4-butylcyclohexyl)-2-fluorophenyl]-1-fluoronaphthalen-2-ol |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc4c(F)c(O)ccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H28F2O/c1-2-3-4-17-5-7-18(8-6-17)19-9-12-22(24(27)16-19)20-10-13-23-21(15-20)11-14-25(29)26(23)28/h9-18,29H,2-8H2,1H3 |
| InChIKey | BBQSGUJDLRKCBX-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |