C20H16F4O — CID 139849915
6-(4-butyl-2,6-difluorophenyl)-1,8-difluoronaphthalen-2-ol (PubChem CID 139849915) has the molecular formula C20H16F4O and a molecular weight of 348.34 g/mol. Its IUPAC name is 6-(4-butyl-2,6-difluorophenyl)-1,8-difluoronaphthalen-2-ol.
| Compound Name | 6-(4-butyl-2,6-difluorophenyl)-1,8-difluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 139849915 |
| Molecular Formula | C20H16F4O |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-(4-butyl-2,6-difluorophenyl)-1,8-difluoronaphthalen-2-ol |
| SMILES | CCCCc1cc(F)c(-c2cc(F)c3c(F)c(O)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H16F4O/c1-2-3-4-11-7-14(21)18(15(22)8-11)13-9-12-5-6-17(25)20(24)19(12)16(23)10-13/h5-10,25H,2-4H2,1H3 |
| InChIKey | LUXRKHKHNVXJSW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |