C29H25F5 — CID 139846711
6-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-2,3-difluoronaphthalene (PubChem CID 139846711) has the molecular formula C29H25F5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139846711 |
| Molecular Formula | C29H25F5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-[2,6-difluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-2,3-difluoronaphthalene |
| SMILES | CCCCCCCc1ccc(-c2cc(F)c(-c3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H25F5/c1-2-3-4-5-6-7-18-8-11-23(24(30)12-18)22-16-27(33)29(28(34)17-22)20-10-9-19-14-25(31)26(32)15-21(19)13-20/h8-17H,2-7H2,1H3 |
| InChIKey | DNNSLUMGZZBVGB-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|