C30H23F5 — CID 139846707
6-[2,6-difluoro-4-[2-(2-fluoro-4-hexylphenyl)ethynyl]phenyl]-2,3-difluoronaphthalene (PubChem CID 139846707) has the molecular formula C30H23F5 and a molecular weight of 478.50 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-[2-(2-fluoro-4-hexylphenyl)ethynyl]phenyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2,6-difluoro-4-[2-(2-fluoro-4-hexylphenyl)ethynyl]phenyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139846707 |
| Molecular Formula | C30H23F5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-[2,6-difluoro-4-[2-(2-fluoro-4-hexylphenyl)ethynyl]phenyl]-2,3-difluoronaphthalene |
| SMILES | CCCCCCc1ccc(C#Cc2cc(F)c(-c3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C30H23F5/c1-2-3-4-5-6-19-7-9-21(25(31)13-19)10-8-20-14-28(34)30(29(35)15-20)23-12-11-22-17-26(32)27(33)18-24(22)16-23/h7,9,11-18H,2-6H2,1H3 |
| InChIKey | LQCHTBHJSAXMBA-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|