C25H16F5NS — CID 171752392
5-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-(3,5-difluoro-4-isothiocyanatophenyl)-1,3-difluorobenzene (PubChem CID 171752392) has the molecular formula C25H16F5NS and a molecular weight of 457.47 g/mol. Its IUPAC name is 5-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-(3,5-difluoro-4-isothiocyanatophenyl)-1,3-difluorobenzene.
| Compound Name | 5-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-(3,5-difluoro-4-isothiocyanatophenyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 171752392 |
| Molecular Formula | C25H16F5NS |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 5-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-(3,5-difluoro-4-isothiocyanatophenyl)-1,3-difluorobenzene |
| SMILES | CCCCc1ccc(C#Cc2cc(F)c(-c3cc(F)c(N=C=S)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H16F5NS/c1-2-3-4-15-5-7-17(19(26)9-15)8-6-16-10-20(27)24(21(28)11-16)18-12-22(29)25(31-14-32)23(30)13-18/h5,7,9-13H,2-4H2,1H3 |
| InChIKey | YSPAWBMFXLJASY-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|