C26H19F4NS — CID 171752246
5-butyl-2-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)-3-methylphenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 171752246) has the molecular formula C26H19F4NS and a molecular weight of 453.50 g/mol. Its IUPAC name is 5-butyl-2-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)-3-methylphenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-butyl-2-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)-3-methylphenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 171752246 |
| Molecular Formula | C26H19F4NS |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 5-butyl-2-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)-3-methylphenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | CCCCc1cc(F)c(C#Cc2ccc(-c3cc(F)c(N=C=S)c(F)c3)c(C)c2)c(F)c1 |
| InChI | InChI=1S/C26H19F4NS/c1-3-4-5-18-11-22(27)21(23(28)12-18)9-7-17-6-8-20(16(2)10-17)19-13-24(29)26(31-15-32)25(30)14-19/h6,8,10-14H,3-5H2,1-2H3 |
| InChIKey | FNSPSPYNTKUPMP-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|