C25H20F4 — CID 67683140
2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluoro-5-pentylbenzene (PubChem CID 67683140) has the molecular formula C25H20F4 and a molecular weight of 396.43 g/mol. Its IUPAC name is 2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 67683140 |
| Molecular Formula | C25H20F4 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[2-[4-(3,4-difluorophenyl)phenyl]ethynyl]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C25H20F4/c1-2-3-4-5-18-14-23(27)21(24(28)15-18)12-8-17-6-9-19(10-7-17)20-11-13-22(26)25(29)16-20/h6-7,9-11,13-16H,2-5H2,1H3 |
| InChIKey | BVLONSOWCHTOSZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|