C30H18F6 — CID 139857736
6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139857736) has the molecular formula C30H18F6 and a molecular weight of 492.46 g/mol. Its IUPAC name is 6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139857736 |
| Molecular Formula | C30H18F6 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | CCCCc1cc(F)c(C#Cc2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C30H18F6/c1-2-3-4-19-12-25(31)24(26(32)13-19)10-7-20-14-27(33)23(28(34)15-20)9-6-18-5-8-21-16-29(35)30(36)17-22(21)11-18/h5,8,11-17H,2-4H2,1H3 |
| InChIKey | JKVTXVUVIHHNQZ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|