C30H18F6O — CID 139857924
6-[2-[4-[2-[2,6-difluoro-4-(3-methoxypropyl)phenyl]ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139857924) has the molecular formula C30H18F6O and a molecular weight of 508.46 g/mol. Its IUPAC name is 6-[2-[4-[2-[2,6-difluoro-4-(3-methoxypropyl)phenyl]ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[4-[2-[2,6-difluoro-4-(3-methoxypropyl)phenyl]ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139857924 |
| Molecular Formula | C30H18F6O |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 6-[2-[4-[2-[2,6-difluoro-4-(3-methoxypropyl)phenyl]ethynyl]-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | COCCCc1cc(F)c(C#Cc2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C30H18F6O/c1-37-10-2-3-19-12-25(31)24(26(32)13-19)9-6-20-14-27(33)23(28(34)15-20)8-5-18-4-7-21-16-29(35)30(36)17-22(21)11-18/h4,7,11-17H,2-3,10H2,1H3 |
| InChIKey | KTGCXCXKIMMDHJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|