C28H26F4O3 — CID 139857592
2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)-1,3-dioxane (PubChem CID 139857592) has the molecular formula C28H26F4O3 and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)-1,3-dioxane.
| Compound Name | 2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)-1,3-dioxane |
|---|---|
| PubChem CID | 139857592 |
| Molecular Formula | C28H26F4O3 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-(3-methoxypropyl)-1,3-dioxane |
| SMILES | COCCCC1COC(CCc2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C28H26F4O3/c1-33-10-2-3-20-16-34-28(35-17-20)9-6-19-12-24(29)23(25(30)13-19)8-5-18-4-7-21-14-26(31)27(32)15-22(21)11-18/h4,7,11-15,20,28H,2-3,6,9-10,16-17H2,1H3 |
| InChIKey | MLRITKSDYVFRTD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|