C25H21F3O3 — CID 139859289
2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-(2-methoxyethyl)-1,3-dioxane (PubChem CID 139859289) has the molecular formula C25H21F3O3 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-(2-methoxyethyl)-1,3-dioxane.
| Compound Name | 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-(2-methoxyethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 139859289 |
| Molecular Formula | C25H21F3O3 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-(2-methoxyethyl)-1,3-dioxane |
| SMILES | COCCC1COC(c2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C25H21F3O3/c1-29-9-8-17-14-30-25(31-15-17)20-7-6-18(22(26)12-20)4-2-16-3-5-19-11-23(27)24(28)13-21(19)10-16/h3,5-7,10-13,17,25H,8-9,14-15H2,1H3 |
| InChIKey | MQZXSNXUHSMYIO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|