C28H20F4O — CID 139858699
2,3-difluoro-6-[2-[2-fluoro-4-[2-fluoro-4-(3-methoxypropyl)phenyl]phenyl]ethynyl]naphthalene (PubChem CID 139858699) has the molecular formula C28H20F4O and a molecular weight of 448.46 g/mol. Its IUPAC name is 2,3-difluoro-6-[2-[2-fluoro-4-[2-fluoro-4-(3-methoxypropyl)phenyl]phenyl]ethynyl]naphthalene.
| Compound Name | 2,3-difluoro-6-[2-[2-fluoro-4-[2-fluoro-4-(3-methoxypropyl)phenyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139858699 |
| Molecular Formula | C28H20F4O |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2,3-difluoro-6-[2-[2-fluoro-4-[2-fluoro-4-(3-methoxypropyl)phenyl]phenyl]ethynyl]naphthalene |
| SMILES | COCCCc1ccc(-c2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H20F4O/c1-33-12-2-3-18-6-11-24(26(30)14-18)22-10-9-20(25(29)16-22)7-4-19-5-8-21-15-27(31)28(32)17-23(21)13-19/h5-6,8-11,13-17H,2-3,12H2,1H3 |
| InChIKey | ZDCGDUCCRCCPOD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|