C24H18F4O3 — CID 139857905
(2S,5R)-2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,4-dioxane (PubChem CID 139857905) has the molecular formula C24H18F4O3 and a molecular weight of 430.40 g/mol. Its IUPAC name is (2S,5R)-2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,4-dioxane.
| Compound Name | (2S,5R)-2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 139857905 |
| Molecular Formula | C24H18F4O3 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (2S,5R)-2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,4-dioxane |
| SMILES | COC[C@@H]1CO[C@@H](c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)CO1 |
| InChI | InChI=1S/C24H18F4O3/c1-29-11-18-12-31-22(13-30-18)16-6-5-15(20(25)9-16)4-2-14-3-7-19-17(8-14)10-21(26)24(28)23(19)27/h3,5-10,18,22H,11-13H2,1H3/t18-,22-/m1/s1 |
| InChIKey | YNWHMPZYPXEUMC-XMSQKQJNSA-N |
| XLogP | 4.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|