C29H28F4O2 — CID 139859402
2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-pentyl-1,3-dioxane (PubChem CID 139859402) has the molecular formula C29H28F4O2 and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 139859402 |
| Molecular Formula | C29H28F4O2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-[2-[3-fluoro-4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C29H28F4O2/c1-2-3-4-5-21-17-34-27(35-18-21)13-9-20-7-11-22(25(30)15-20)10-6-19-8-12-24-23(14-19)16-26(31)29(33)28(24)32/h7-8,11-12,14-16,21,27H,2-5,9,13,17-18H2,1H3 |
| InChIKey | AJVXBJYOCVYTNK-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|