C29H27F3O2 — CID 139858925
5-[(E)-pent-3-enyl]-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane (PubChem CID 139858925) has the molecular formula C29H27F3O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 5-[(E)-pent-3-enyl]-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane.
| Compound Name | 5-[(E)-pent-3-enyl]-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139858925 |
| Molecular Formula | C29H27F3O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 5-[(E)-pent-3-enyl]-2-[2-[4-[2-(5,6,7-trifluoronaphthalen-2-yl)ethynyl]phenyl]ethyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)OC1 |
| InChI | InChI=1S/C29H27F3O2/c1-2-3-4-5-23-18-33-27(34-19-23)15-13-21-8-6-20(7-9-21)10-11-22-12-14-25-24(16-22)17-26(30)29(32)28(25)31/h2-3,6-9,12,14,16-17,23,27H,4-5,13,15,18-19H2,1H3/b3-2+ |
| InChIKey | QPNHIQMTQLQKJX-NSCUHMNNSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|