C27H22F4O2 — CID 139858514
2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 139858514) has the molecular formula C27H22F4O2 and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139858514 |
| Molecular Formula | C27H22F4O2 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C27H22F4O2/c1-2-3-4-5-18-15-32-27(33-16-18)20-13-24(29)22(25(30)14-20)10-7-17-6-9-21-19(12-17)8-11-23(28)26(21)31/h2-3,6,8-9,11-14,18,27H,4-5,15-16H2,1H3/b3-2+ |
| InChIKey | PGNDJXDFGJEVFK-NSCUHMNNSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|