C22H18F4O2 — CID 67851198
5-but-3-enyl-2-[4-[2-(3,4-difluorophenyl)ethynyl]-3,5-difluorophenyl]-1,3-dioxane (PubChem CID 67851198) has the molecular formula C22H18F4O2 and a molecular weight of 390.38 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[2-(3,4-difluorophenyl)ethynyl]-3,5-difluorophenyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-[2-(3,4-difluorophenyl)ethynyl]-3,5-difluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67851198 |
| Molecular Formula | C22H18F4O2 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-but-3-enyl-2-[4-[2-(3,4-difluorophenyl)ethynyl]-3,5-difluorophenyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(c2cc(F)c(C#Cc3ccc(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H18F4O2/c1-2-3-4-15-12-27-22(28-13-15)16-10-19(24)17(20(25)11-16)7-5-14-6-8-18(23)21(26)9-14/h2,6,8-11,15,22H,1,3-4,12-13H2 |
| InChIKey | LDNGMDFVZCQJII-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|