C14H17ClO2 — CID 18652891
5-but-3-enyl-2-(4-chlorophenyl)-1,3-dioxane (PubChem CID 18652891) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 5-but-3-enyl-2-(4-chlorophenyl)-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-(4-chlorophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 18652891 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-but-3-enyl-2-(4-chlorophenyl)-1,3-dioxane |
| SMILES | C=CCCC1COC(c2ccc(Cl)cc2)OC1 |
| InChI | InChI=1S/C14H17ClO2/c1-2-3-4-11-9-16-14(17-10-11)12-5-7-13(15)8-6-12/h2,5-8,11,14H,1,3-4,9-10H2 |
| InChIKey | QCFZXEUMDXJOFS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|