C22H21F3O2 — CID 67685872
2-[3,5-difluoro-4-[2-(3-fluoro-4-methylphenyl)ethynyl]phenyl]-5-propyl-1,3-dioxane (PubChem CID 67685872) has the molecular formula C22H21F3O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[2-(3-fluoro-4-methylphenyl)ethynyl]phenyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[3,5-difluoro-4-[2-(3-fluoro-4-methylphenyl)ethynyl]phenyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 67685872 |
| Molecular Formula | C22H21F3O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[3,5-difluoro-4-[2-(3-fluoro-4-methylphenyl)ethynyl]phenyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(c2cc(F)c(C#Cc3ccc(C)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H21F3O2/c1-3-4-16-12-26-22(27-13-16)17-10-20(24)18(21(25)11-17)8-7-15-6-5-14(2)19(23)9-15/h5-6,9-11,16,22H,3-4,12-13H2,1-2H3 |
| InChIKey | MQMUATKKQBBKFN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|