C19H19ClF2O2 — CID 54471568
2-[4-(4-chlorophenyl)-3,5-difluorophenyl]-5-propyl-1,3-dioxane (PubChem CID 54471568) has the molecular formula C19H19ClF2O2 and a molecular weight of 352.81 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-3,5-difluorophenyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-(4-chlorophenyl)-3,5-difluorophenyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 54471568 |
| Molecular Formula | C19H19ClF2O2 |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-3,5-difluorophenyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(c2cc(F)c(-c3ccc(Cl)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C19H19ClF2O2/c1-2-3-12-10-23-19(24-11-12)14-8-16(21)18(17(22)9-14)13-4-6-15(20)7-5-13/h4-9,12,19H,2-3,10-11H2,1H3 |
| InChIKey | XISNHYGPOIDSFB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |