C27H26F4O2 — CID 118459119
2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane (PubChem CID 118459119) has the molecular formula C27H26F4O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 118459119 |
| Molecular Formula | C27H26F4O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[4-[4-(3,4-difluorophenyl)-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(-c3cc(F)c(-c4ccc(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C27H26F4O2/c1-2-3-4-5-17-15-32-27(33-16-17)19-8-6-18(7-9-19)21-13-24(30)26(25(31)14-21)20-10-11-22(28)23(29)12-20/h6-14,17,27H,2-5,15-16H2,1H3 |
| InChIKey | KWOJNGQEBWSBPW-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|