C21H31FO4 — CID 22910587
2-(4-fluorophenyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane (PubChem CID 22910587) has the molecular formula C21H31FO4 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane.
| Compound Name | 2-(4-fluorophenyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910587 |
| Molecular Formula | C21H31FO4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane |
| SMILES | CCCCCC1COC(CCC2COC(c3ccc(F)cc3)OC2)OC1 |
| InChI | InChI=1S/C21H31FO4/c1-2-3-4-5-16-12-23-20(24-13-16)11-6-17-14-25-21(26-15-17)18-7-9-19(22)10-8-18/h7-10,16-17,20-21H,2-6,11-15H2,1H3 |
| InChIKey | VNLBQKAVGZMHAJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|