C22H31F3O4 — CID 22910620
5-hexyl-2-[2-[2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane (PubChem CID 22910620) has the molecular formula C22H31F3O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 5-hexyl-2-[2-[2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane.
| Compound Name | 5-hexyl-2-[2-[2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910620 |
| Molecular Formula | C22H31F3O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 5-hexyl-2-[2-[2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]ethyl]-1,3-dioxane |
| SMILES | CCCCCCC1COC(CCC2COC(c3cc(F)c(F)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C22H31F3O4/c1-2-3-4-5-6-15-11-26-20(27-12-15)8-7-16-13-28-22(29-14-16)17-9-18(23)21(25)19(24)10-17/h9-10,15-16,20,22H,2-8,11-14H2,1H3 |
| InChIKey | DSRMXNSOHOVNGW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|