C24H33F5O5 — CID 22910611
5-butyl-2-[4-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-dioxan-5-yl]butyl]-1,3-dioxane (PubChem CID 22910611) has the molecular formula C24H33F5O5 and a molecular weight of 496.51 g/mol. Its IUPAC name is 5-butyl-2-[4-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-dioxan-5-yl]butyl]-1,3-dioxane.
| Compound Name | 5-butyl-2-[4-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-dioxan-5-yl]butyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910611 |
| Molecular Formula | C24H33F5O5 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 5-butyl-2-[4-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-dioxan-5-yl]butyl]-1,3-dioxane |
| SMILES | CCCCC1COC(CCCCC2COC(c3cc(F)c(OCC(F)(F)F)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C24H33F5O5/c1-2-3-6-16-11-30-21(31-12-16)8-5-4-7-17-13-32-23(33-14-17)18-9-19(25)22(20(26)10-18)34-15-24(27,28)29/h9-10,16-17,21,23H,2-8,11-15H2,1H3 |
| InChIKey | RXQDFOGLQRURRI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|