C22H19F7O5 — CID 154526951
[3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(5-butyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate (PubChem CID 154526951) has the molecular formula C22H19F7O5 and a molecular weight of 496.38 g/mol. Its IUPAC name is [3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(5-butyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate.
| Compound Name | [3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(5-butyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 154526951 |
| Molecular Formula | C22H19F7O5 |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [3,5-difluoro-4-(trifluoromethoxy)phenyl] 4-(5-butyl-1,3-dioxan-2-yl)-2,6-difluorobenzoate |
| SMILES | CCCCC1COC(c2cc(F)c(C(=O)Oc3cc(F)c(OC(F)(F)F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H19F7O5/c1-2-3-4-11-9-31-21(32-10-11)12-5-14(23)18(15(24)6-12)20(30)33-13-7-16(25)19(17(26)8-13)34-22(27,28)29/h5-8,11,21H,2-4,9-10H2,1H3 |
| InChIKey | FKKDXUBLEOCCCL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|