C32H33F9O6 — CID 122577091
[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl] 2,6-difluoro-4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]benzoate (PubChem CID 122577091) has the molecular formula C32H33F9O6 and a molecular weight of 684.59 g/mol. Its IUPAC name is [4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl] 2,6-difluoro-4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]benzoate.
| Compound Name | [4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl] 2,6-difluoro-4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]benzoate |
|---|---|
| PubChem CID | 122577091 |
| Molecular Formula | C32H33F9O6 |
| Molecular Weight | 684.59 g/mol |
| Exact Mass | 684.21 |
| IUPAC Name | [4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl] 2,6-difluoro-4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]benzoate |
| SMILES | C/C=C/CCCCC1COC(c2cc(F)c(C(=O)OC3CCC(C(F)(F)Oc4cc(F)c(OC(F)(F)F)c(F)c4)CC3)c(F)c2)OC1 |
| InChI | InChI=1S/C32H33F9O6/c1-2-3-4-5-6-7-18-16-43-30(44-17-18)19-12-23(33)27(24(34)13-19)29(42)45-21-10-8-20(9-11-21)31(37,38)46-22-14-25(35)28(26(36)15-22)47-32(39,40)41/h2-3,12-15,18,20-21,30H,4-11,16-17H2,1H3/b3-2+ |
| InChIKey | DJHORZYLRZSRRF-NSCUHMNNSA-N |
| XLogP | 9.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.59 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|