C27H37F5O — CID 67589702
1,3-difluoro-5-[2-[4-[4-[(E)-hex-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene (PubChem CID 67589702) has the molecular formula C27H37F5O and a molecular weight of 472.58 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-[4-[(E)-hex-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[2-[4-[4-[(E)-hex-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 67589702 |
| Molecular Formula | C27H37F5O |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-[4-[(E)-hex-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene |
| SMILES | C/C=C/CCCC1CCC(C2CCC(CCc3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H37F5O/c1-2-3-4-5-6-19-9-13-22(14-10-19)23-15-11-20(12-16-23)7-8-21-17-24(28)26(25(29)18-21)33-27(30,31)32/h2-3,17-20,22-23H,4-16H2,1H3/b3-2+ |
| InChIKey | ACSOWYUZXBGPHQ-NSCUHMNNSA-N |
| XLogP | 9.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|