C20H25F5O — CID 54261230
1,3-difluoro-5-[2-(4-pent-3-enylcyclohexyl)ethyl]-2-(trifluoromethoxy)benzene (PubChem CID 54261230) has the molecular formula C20H25F5O and a molecular weight of 376.41 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-(4-pent-3-enylcyclohexyl)ethyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[2-(4-pent-3-enylcyclohexyl)ethyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54261230 |
| Molecular Formula | C20H25F5O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1,3-difluoro-5-[2-(4-pent-3-enylcyclohexyl)ethyl]-2-(trifluoromethoxy)benzene |
| SMILES | CC=CCCC1CCC(CCc2cc(F)c(OC(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H25F5O/c1-2-3-4-5-14-6-8-15(9-7-14)10-11-16-12-17(21)19(18(22)13-16)26-20(23,24)25/h2-3,12-15H,4-11H2,1H3 |
| InChIKey | RDQGLKSNLIFZAC-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|