C26H35F5O — CID 54258081
1,3-difluoro-5-[4-(4-hept-3-enylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene (PubChem CID 54258081) has the molecular formula C26H35F5O and a molecular weight of 458.56 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(4-hept-3-enylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[4-(4-hept-3-enylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54258081 |
| Molecular Formula | C26H35F5O |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 1,3-difluoro-5-[4-(4-hept-3-enylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene |
| SMILES | CCCC=CCCC1CCC(C2CCC(c3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H35F5O/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-23(27)25(24(28)17-22)32-26(29,30)31/h4-5,16-21H,2-3,6-15H2,1H3 |
| InChIKey | RBMCBYGLNALWSF-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|