C25H34F4O — CID 54282576
2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-hex-3-enylcyclohexyl)cyclohexyl]benzene (PubChem CID 54282576) has the molecular formula C25H34F4O and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-hex-3-enylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-hex-3-enylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 54282576 |
| Molecular Formula | C25H34F4O |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-(difluoromethoxy)-1,3-difluoro-5-[4-(4-hex-3-enylcyclohexyl)cyclohexyl]benzene |
| SMILES | CCC=CCCC1CCC(C2CCC(c3cc(F)c(OC(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H34F4O/c1-2-3-4-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21-15-22(26)24(23(27)16-21)30-25(28)29/h3-4,15-20,25H,2,5-14H2,1H3 |
| InChIKey | RRUYDEQJIDVALO-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|