C27H38F4O — CID 139629380
5-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene (PubChem CID 139629380) has the molecular formula C27H38F4O and a molecular weight of 454.59 g/mol. Its IUPAC name is 5-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene.
| Compound Name | 5-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 139629380 |
| Molecular Formula | C27H38F4O |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 5-[4-[(E)-4-(4-butylcyclohexyl)but-3-enyl]cyclohexyl]-2-(difluoromethoxy)-1,3-difluorobenzene |
| SMILES | CCCCC1CCC(/C=C/CCC2CCC(c3cc(F)c(OC(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H38F4O/c1-2-3-6-19-9-11-20(12-10-19)7-4-5-8-21-13-15-22(16-14-21)23-17-24(28)26(25(29)18-23)32-27(30)31/h4,7,17-22,27H,2-3,5-6,8-16H2,1H3/b7-4+ |
| InChIKey | IAUGGLGFAIZCCB-QPJJXVBHSA-N |
| XLogP | 9.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|