C27H37F5 — CID 139629279
5-[4-[(E)-4-(4-butylcyclohexyl)but-1-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 139629279) has the molecular formula C27H37F5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 5-[4-[(E)-4-(4-butylcyclohexyl)but-1-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene.
| Compound Name | 5-[4-[(E)-4-(4-butylcyclohexyl)but-1-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139629279 |
| Molecular Formula | C27H37F5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 5-[4-[(E)-4-(4-butylcyclohexyl)but-1-enyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | CCCCC1CCC(CC/C=C/C2CCC(c3cc(F)c(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H37F5/c1-2-3-6-19-9-11-20(12-10-19)7-4-5-8-21-13-15-22(16-14-21)23-17-24(28)26(25(29)18-23)27(30,31)32/h5,8,17-22H,2-4,6-7,9-16H2,1H3/b8-5+ |
| InChIKey | USIRXLGOVYGHSI-VMPITWQZSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|