C17H17F7 — CID 54047120
5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 54047120) has the molecular formula C17H17F7 and a molecular weight of 354.31 g/mol. Its IUPAC name is 5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene.
| Compound Name | 5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54047120 |
| Molecular Formula | C17H17F7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-[4-(4,4-difluorobut-1-enyl)cyclohexyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | Fc1cc(C2CCC(C=CCC(F)F)CC2)cc(F)c1C(F)(F)F |
| InChI | InChI=1S/C17H17F7/c18-13-8-12(9-14(19)16(13)17(22,23)24)11-6-4-10(5-7-11)2-1-3-15(20)21/h1-2,8-11,15H,3-7H2 |
| InChIKey | LQISWZDDEIZUFP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|