C16H17F5 — CID 18658497
1,3-difluoro-5-(4-prop-2-enylcyclohexyl)-2-(trifluoromethyl)benzene (PubChem CID 18658497) has the molecular formula C16H17F5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-prop-2-enylcyclohexyl)-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-(4-prop-2-enylcyclohexyl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 18658497 |
| Molecular Formula | C16H17F5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1,3-difluoro-5-(4-prop-2-enylcyclohexyl)-2-(trifluoromethyl)benzene |
| SMILES | C=CCC1CCC(c2cc(F)c(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H17F5/c1-2-3-10-4-6-11(7-5-10)12-8-13(17)15(14(18)9-12)16(19,20)21/h2,8-11H,1,3-7H2 |
| InChIKey | CWDBAOGXASTORV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|